cas: 87694-53-9 — see every product listed under this CAS number, including other names
(S)-tert-Butyl (1-(methoxy(methyl)amino)-1-oxo-3-phenylpropan-2-yl)carbamate, 98%, 98% (CAS 87694-53-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115NS1-1g |
| cas | 87694-53-9 |
| size | 1g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 630.80 Pln | |
| Chemat | 25g | 1763.60 Pln | |
| Chemat | 100g | 5670.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate (CAS 87694-53-9) is a chemical compound with the molecular formula C16H24N2O4 and a molecular weight of 308.37 g/mol. IUPAC name: tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate. InChIKey: ZAHRDPIWMGLOQJ-ZDUSSCGKSA-N.
| Molecular formula | C16H24N2O4 |
|---|---|
| Molecular weight | 308.37 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| InChIKey | ZAHRDPIWMGLOQJ-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N(C)OC |
Computed by PubChem (NCBI)