CAS 883554-90-3 appears in our catalog under these names: N,N-Di-boc-benzene-1,4-diamine, 95%, N,N-Di-tert-butoxycarbonyl-benzene-1,4-diamine, 95+%, N,N-Di-tert-butoxycarbonyl-benzene-1,4-diamine 95+%, N,N-Di-tert-butoxycarbonyl-benzene-1,4-diamine. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100mg, 250mg.
Tert-butyl N-(4-aminophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 883554-90-3) is a chemical compound with the molecular formula C16H24N2O4 and a molecular weight of 308.37 g/mol. IUPAC name: tert-butyl N-(4-aminophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: DPNHHUDUEAJVPX-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O4 |
|---|---|
| Molecular weight | 308.37 g/mol |
| IUPAC name | tert-butyl N-(4-aminophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | DPNHHUDUEAJVPX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=CC=C(C=C1)N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)