CAS 1873315-37-7 is the registry number for tert-Butyl (s)-2-benzyl-2-(1-methoxy-1-oxopropan-2-yl)hydrazine-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Methyl (2S)-2-[benzyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]propanoate (CAS 1873315-37-7) is a chemical compound with the molecular formula C16H24N2O4 and a molecular weight of 308.37 g/mol. IUPAC name: methyl (2S)-2-[benzyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]propanoate. InChIKey: JUTLUOUYFKHOBY-LBPRGKRZSA-N.
| Molecular formula | C16H24N2O4 |
|---|---|
| Molecular weight | 308.37 g/mol |
| IUPAC name | methyl (2S)-2-[benzyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]propanoate |
| InChIKey | JUTLUOUYFKHOBY-LBPRGKRZSA-N |
| SMILES | C[C@@H](C(=O)OC)N(CC1=CC=CC=C1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)