cas: 148983-25-9 — see every product listed under this CAS number, including other names
(S)-tert-Butyl (2,3-dihydroxypropyl)carbamate 98% (CAS 148983-25-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A940988-250mg |
| cas | 148983-25-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 559.50 Pln | |
| Ambeed | 5g | 1761.00 Pln | |
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 10g | 3023.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A940988 |
Tert-butyl N-[(2S)-2,3-dihydroxypropyl]carbamate (CAS 148983-25-9) is a chemical compound with the molecular formula C8H17NO4 and a molecular weight of 191.22 g/mol. IUPAC name: tert-butyl N-[(2S)-2,3-dihydroxypropyl]carbamate. InChIKey: OWAMQHJPVUGZSB-LURJTMIESA-N.
| Molecular formula | C8H17NO4 |
|---|---|
| Molecular weight | 191.22 g/mol |
| IUPAC name | tert-butyl N-[(2S)-2,3-dihydroxypropyl]carbamate |
| InChIKey | OWAMQHJPVUGZSB-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](CO)O |
Computed by PubChem (NCBI)