cas: 1075260-66-0 — see every product listed under this CAS number, including other names
(S)-tert-Butyl (pyrrolidin-3-ylmethyl)carbamate hydrochloride, 97%, 97% (CAS 1075260-66-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119YCJ-100mg |
| cas | 1075260-66-0 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1509.20 Pln | |
| Chemat | 25g | 2958.80 Pln | |
| Chemat | 50g | 4610.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[[(3S)-pyrrolidin-3-yl]methyl]carbamate;hydrochloride (CAS 1075260-66-0) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-[[(3S)-pyrrolidin-3-yl]methyl]carbamate;hydrochloride. InChIKey: WEUDEPABMRKFFT-QRPNPIFTSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-[[(3S)-pyrrolidin-3-yl]methyl]carbamate;hydrochloride |
| InChIKey | WEUDEPABMRKFFT-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1CCNC1.Cl |
Computed by PubChem (NCBI)