cas: 1260616-94-1 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 2-(2-chloroacetyl)azetidine-1-carboxylate 98+% (CAS 1260616-94-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A378533-100mg |
| cas | 1260616-94-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 698.56 Pln | |
| Ambeed | 250mg | 1037.88 Pln | |
| Ambeed | 1g | 2984.75 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A378533 |
Tert-butyl (2S)-2-(2-chloroacetyl)azetidine-1-carboxylate (CAS 1260616-94-1) is a chemical compound with the molecular formula C10H16ClNO3 and a molecular weight of 233.69 g/mol. IUPAC name: tert-butyl (2S)-2-(2-chloroacetyl)azetidine-1-carboxylate. InChIKey: RITDKFINXLSZFM-ZETCQYMHSA-N.
| Molecular formula | C10H16ClNO3 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | tert-butyl (2S)-2-(2-chloroacetyl)azetidine-1-carboxylate |
| InChIKey | RITDKFINXLSZFM-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1C(=O)CCl |
Computed by PubChem (NCBI)