cas: 1260616-94-1 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 2-(2-chloroacetyl)azetidine-1-carboxylate, 97%, 97% (CAS 1260616-94-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111QX4-250mg |
| cas | 1260616-94-1 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 645.20 Pln | |
| Chemat | 500mg | 1226.00 Pln | |
| Chemat | 1g | 1682.00 Pln | |
| Chemat | 5g | 4922.00 Pln | |
| Chemat | 10g | 9141.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-2-(2-chloroacetyl)azetidine-1-carboxylate (CAS 1260616-94-1) is a chemical compound with the molecular formula C10H16ClNO3 and a molecular weight of 233.69 g/mol. IUPAC name: tert-butyl (2S)-2-(2-chloroacetyl)azetidine-1-carboxylate. InChIKey: RITDKFINXLSZFM-ZETCQYMHSA-N.
| Molecular formula | C10H16ClNO3 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | tert-butyl (2S)-2-(2-chloroacetyl)azetidine-1-carboxylate |
| InChIKey | RITDKFINXLSZFM-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1C(=O)CCl |
Computed by PubChem (NCBI)