cas: 1363378-23-7 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 2-(bromomethyl)azetidine-1-carboxylate, 98% (CAS 1363378-23-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F498174-100MG |
| cas | 1363378-23-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 893.45 Pln | |
| Fluorochem | 250mg | 1414.10 Pln | |
| Fluorochem | 1g | 3548.77 Pln | |
| Fluorochem | 10g | 30836.03 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (2S)-2-(bromomethyl)azetidine-1-carboxylate (CAS 1363378-23-7) is a chemical compound with the molecular formula C9H16BrNO2 and a molecular weight of 250.13 g/mol. IUPAC name: tert-butyl (2S)-2-(bromomethyl)azetidine-1-carboxylate. InChIKey: YDUBHKXBYBMWRH-ZETCQYMHSA-N.
| Molecular formula | C9H16BrNO2 |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | tert-butyl (2S)-2-(bromomethyl)azetidine-1-carboxylate |
| InChIKey | YDUBHKXBYBMWRH-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1CBr |
Computed by PubChem (NCBI)