CAS 197358-53-5 appears in our catalog under these names: (S)-tert-Butyl 2-amino-3-((tert-butoxycarbonyl)amino)propanoate hydrochloride, 97%, 97%, (S)-tert-Butyl 2-amino-3-((tert-butoxycarbonyl)amino)propanoate hydrochloride, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 5g, 25g, 100g, 500g.
Tert-butyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride (CAS 197358-53-5) is a chemical compound with the molecular formula C12H25ClN2O4 and a molecular weight of 296.79 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride. InChIKey: RMMATBBIKAKDDP-QRPNPIFTSA-N.
| Molecular formula | C12H25ClN2O4 |
|---|---|
| Molecular weight | 296.79 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride |
| InChIKey | RMMATBBIKAKDDP-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CNC(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)