cas: 1589082-06-3 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 3-(cyanomethyl)piperazine-1-carboxylate, 97% (CAS 1589082-06-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546199-100MG |
| cas | 1589082-06-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 919.49 Pln | |
| Fluorochem | 5g | 3168.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3S)-3-(cyanomethyl)piperazine-1-carboxylate (CAS 1589082-06-3) is a chemical compound with the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. IUPAC name: tert-butyl (3S)-3-(cyanomethyl)piperazine-1-carboxylate. InChIKey: PQMGXPIFQIFJEX-VIFPVBQESA-N.
| Molecular formula | C11H19N3O2 |
|---|---|
| Molecular weight | 225.29 g/mol |
| IUPAC name | tert-butyl (3S)-3-(cyanomethyl)piperazine-1-carboxylate |
| InChIKey | PQMGXPIFQIFJEX-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@H](C1)CC#N |
Computed by PubChem (NCBI)