Products 15871-54-2
CAS 15871-54-2 appears in our catalog under these names: 7,7,9,9-Tetramethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione, 95%, 7,7,9,9-Tetramethyl-1,3,8-triazaspiro(4.5)decane-2,4-dione, 97%, 7,7,9,9-Tetramethyl-1,3,8-triazaspiro(4.5)decane-2,4-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
7,7,9,9-tetramethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (CAS 15871-54-2) is a chemical compound with the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. IUPAC name: 7,7,9,9-tetramethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione. InChIKey: PNJCQCUNRRANAF-UHFFFAOYSA-N.
| Molecular formula | C11H19N3O2 |
|---|---|
| Molecular weight | 225.29 g/mol |
| IUPAC name | 7,7,9,9-tetramethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| InChIKey | PNJCQCUNRRANAF-UHFFFAOYSA-N |
| SMILES | CC1(CC2(CC(N1)(C)C)C(=O)NC(=O)N2)C |
Computed by PubChem (NCBI)