Products 1807608-40-7

CAS 1807608-40-7 appears in our catalog under these names: Morinidazole Impurity 5, Morinidazole Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(2-methylimidazol-1-yl)-3-morpholin-4-ylpropan-2-ol (CAS 1807608-40-7) is a chemical compound with the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. IUPAC name: 1-(2-methylimidazol-1-yl)-3-morpholin-4-ylpropan-2-ol. InChIKey: OOTAAZUNLZJUJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19N3O2
Molecular weight225.29 g/mol
IUPAC name1-(2-methylimidazol-1-yl)-3-morpholin-4-ylpropan-2-ol
InChIKeyOOTAAZUNLZJUJJ-UHFFFAOYSA-N
SMILESCC1=NC=CN1CC(CN2CCOCC2)O

Computed by PubChem (NCBI)