cas: 314741-40-7 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 3-(hydroxymethyl)piperazine-1-carboxylate 98% (CAS 314741-40-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A109002-100mg |
| cas | 314741-40-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 10g | 309.19 Pln | |
| Ambeed | 25g | 498.31 Pln | |
| Ambeed | 100g | 1610.81 Pln | |
| Ambeed | 500g | 6700.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A109002 |
Tert-butyl (3S)-3-(hydroxymethyl)piperazine-1-carboxylate (CAS 314741-40-7) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (3S)-3-(hydroxymethyl)piperazine-1-carboxylate. InChIKey: NSILYQWHARROMG-QMMMGPOBSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (3S)-3-(hydroxymethyl)piperazine-1-carboxylate |
| InChIKey | NSILYQWHARROMG-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@@H](C1)CO |
Computed by PubChem (NCBI)