cas: 314741-40-7 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 3-(hydroxymethyl)piperazine-1-carboxylate, 98%, 98% (CAS 314741-40-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CMN-250mg |
| cas | 314741-40-7 |
| size | 250mg |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 179.60 Pln | |
| Chemat | 25g | 318.80 Pln | |
| Chemat | 50g | 510.80 Pln | |
| Chemat | 100g | 818.00 Pln | |
| Chemat | 250g | 1854.80 Pln | |
| Chemat | 500g | 3235.20 Pln | |
| Chemat | 1kg | 4605.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3S)-3-(hydroxymethyl)piperazine-1-carboxylate (CAS 314741-40-7) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (3S)-3-(hydroxymethyl)piperazine-1-carboxylate. InChIKey: NSILYQWHARROMG-QMMMGPOBSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (3S)-3-(hydroxymethyl)piperazine-1-carboxylate |
| InChIKey | NSILYQWHARROMG-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@@H](C1)CO |
Computed by PubChem (NCBI)