cas: 1171128-34-9 — see every product listed under this CAS number, including other names
(Z)-2-(2,4-Dioxothiazolidin-5-ylidene)acetic acid, 95+% (CAS 1171128-34-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A418163-1g |
| cas | 1171128-34-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 994.42 Pln | |
| AmBeed | 250mg | 525.70 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2Z)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetic acid (CAS 1171128-34-9) is a chemical compound with the molecular formula C5H3NO4S and a molecular weight of 173.15 g/mol. IUPAC name: (2Z)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetic acid. InChIKey: GZMAUGAAAMRIDY-UPHRSURJSA-N.
| Molecular formula | C5H3NO4S |
|---|---|
| Molecular weight | 173.15 g/mol |
| IUPAC name | (2Z)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetic acid |
| InChIKey | GZMAUGAAAMRIDY-UPHRSURJSA-N |
| SMILES | C(=C\1/C(=O)NC(=O)S1)\C(=O)O |
Computed by PubChem (NCBI)