Products 89379-29-3

CAS 89379-29-3 is the registry number for Thiazole-2,4-dicarboxylic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1,3-thiazole-2,4-dicarboxylic acid (CAS 89379-29-3) is a chemical compound with the molecular formula C5H3NO4S and a molecular weight of 173.15 g/mol. IUPAC name: 1,3-thiazole-2,4-dicarboxylic acid. InChIKey: RUTJJFYMKNSTIA-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3NO4S
Molecular weight173.15 g/mol
IUPAC name1,3-thiazole-2,4-dicarboxylic acid
InChIKeyRUTJJFYMKNSTIA-UHFFFAOYSA-N
SMILESC1=C(N=C(S1)C(=O)O)C(=O)O

Computed by PubChem (NCBI)