CAS 89379-29-3 is the registry number for Thiazole-2,4-dicarboxylic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1,3-thiazole-2,4-dicarboxylic acid (CAS 89379-29-3) is a chemical compound with the molecular formula C5H3NO4S and a molecular weight of 173.15 g/mol. IUPAC name: 1,3-thiazole-2,4-dicarboxylic acid. InChIKey: RUTJJFYMKNSTIA-UHFFFAOYSA-N.
| Molecular formula | C5H3NO4S |
|---|---|
| Molecular weight | 173.15 g/mol |
| IUPAC name | 1,3-thiazole-2,4-dicarboxylic acid |
| InChIKey | RUTJJFYMKNSTIA-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)