CAS 40357-96-8 appears in our catalog under these names: 5-Nitrothiophene-3-carboxylic acid, 97% , 5-Nitrothiophene-3-carboxylic acid 98%, 5-Nitrothiophene-3-carboxylic acid, 98%, 98%, 5-Nitrothiophene-3-carboxylic acid, 98%. Offered by: Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 250MG, 1g, 5g, 25g, 100g, 10g.
5-nitrothiophene-3-carboxylic acid (CAS 40357-96-8) is a chemical compound with the molecular formula C5H3NO4S and a molecular weight of 173.15 g/mol. IUPAC name: 5-nitrothiophene-3-carboxylic acid. InChIKey: VNJUNWUOAKEIKG-UHFFFAOYSA-N.
| Molecular formula | C5H3NO4S |
|---|---|
| Molecular weight | 173.15 g/mol |
| IUPAC name | 5-nitrothiophene-3-carboxylic acid |
| InChIKey | VNJUNWUOAKEIKG-UHFFFAOYSA-N |
| SMILES | C1=C(SC=C1C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)