cas: 1160264-44-7 — see every product listed under this CAS number, including other names
(Z)-3,5-Diamino-2-cyano-5-oxopent-2-enoic acid, 97% (CAS 1160264-44-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A728967-5g |
| cas | 1160264-44-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 3533.32 Pln | |
| AmBeed | 1g | 1228.78 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(Z)-3,5-diamino-2-cyano-5-oxopent-2-enoic acid (CAS 1160264-44-7) is a chemical compound with the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. IUPAC name: (Z)-3,5-diamino-2-cyano-5-oxopent-2-enoic acid. InChIKey: NDFKZNWOJRIMHX-ARJAWSKDSA-N.
| Molecular formula | C6H7N3O3 |
|---|---|
| Molecular weight | 169.14 g/mol |
| IUPAC name | (Z)-3,5-diamino-2-cyano-5-oxopent-2-enoic acid |
| InChIKey | NDFKZNWOJRIMHX-ARJAWSKDSA-N |
| SMILES | C(/C(=C(\C#N)/C(=O)O)/N)C(=O)N |
Computed by PubChem (NCBI)