CAS 1160264-44-7 appears in our catalog under these names: (2Z)-3,5-Diamino-2-cyano-5-oxopent-2-enoic acid, 95%, (Z)-3,5-Diamino-2-cyano-5-oxopent-2-enoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 5g, 1g.
(Z)-3,5-diamino-2-cyano-5-oxopent-2-enoic acid (CAS 1160264-44-7) is a chemical compound with the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. IUPAC name: (Z)-3,5-diamino-2-cyano-5-oxopent-2-enoic acid. InChIKey: NDFKZNWOJRIMHX-ARJAWSKDSA-N.
| Molecular formula | C6H7N3O3 |
|---|---|
| Molecular weight | 169.14 g/mol |
| IUPAC name | (Z)-3,5-diamino-2-cyano-5-oxopent-2-enoic acid |
| InChIKey | NDFKZNWOJRIMHX-ARJAWSKDSA-N |
| SMILES | C(/C(=C(\C#N)/C(=O)O)/N)C(=O)N |
Computed by PubChem (NCBI)