Products 16312-52-0

CAS 16312-52-0 is the registry number for 3-Amino-6-methoxypyrazine-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-amino-6-methoxypyrazine-2-carboxylic acid (CAS 16312-52-0) is a chemical compound with the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. IUPAC name: 3-amino-6-methoxypyrazine-2-carboxylic acid. InChIKey: PFNOLVBWVBBRMV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7N3O3
Molecular weight169.14 g/mol
IUPAC name3-amino-6-methoxypyrazine-2-carboxylic acid
InChIKeyPFNOLVBWVBBRMV-UHFFFAOYSA-N
SMILESCOC1=CN=C(C(=N1)C(=O)O)N

Computed by PubChem (NCBI)