cas: 4545-21-5 — see every product listed under this CAS number, including other names
(Z)-4-methyl-N'-(1-phenylethylidene)benzenesulfonohydrazide, 98% (CAS 4545-21-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F773927-5G |
| cas | 4545-21-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 289.50 Pln | |
| Fluorochem | 10g | 529.00 Pln | |
| Fluorochem | 25g | 1216.26 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-methyl-N-(1-phenylethylideneamino)benzenesulfonamide (CAS 4545-21-5) is a chemical compound with the molecular formula C15H16N2O2S and a molecular weight of 288.4 g/mol. IUPAC name: 4-methyl-N-(1-phenylethylideneamino)benzenesulfonamide. InChIKey: MIXFDFCKBMCLGN-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O2S |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 4-methyl-N-(1-phenylethylideneamino)benzenesulfonamide |
| InChIKey | MIXFDFCKBMCLGN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NN=C(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)