CAS 35629-84-6 is the registry number for 4–Methyl–N–(2–methylbenzylidene)benzenesulfonohydrazide. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
4-methyl-N-[(E)-(2-methylphenyl)methylideneamino]benzenesulfonamide (CAS 35629-84-6) is a chemical compound with the molecular formula C15H16N2O2S and a molecular weight of 288.4 g/mol. IUPAC name: 4-methyl-N-[(E)-(2-methylphenyl)methylideneamino]benzenesulfonamide. InChIKey: WBNXGRRFYWWFBO-LFIBNONCSA-N.
| Molecular formula | C15H16N2O2S |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 4-methyl-N-[(E)-(2-methylphenyl)methylideneamino]benzenesulfonamide |
| InChIKey | WBNXGRRFYWWFBO-LFIBNONCSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CC=CC=C2C |
Computed by PubChem (NCBI)