CAS 927997-18-0 is the registry number for 1-Tosylindolin-6-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-6-amine (CAS 927997-18-0) is a chemical compound with the molecular formula C15H16N2O2S and a molecular weight of 288.4 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-6-amine. InChIKey: SSYBWYBCJQEDOB-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O2S |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-6-amine |
| InChIKey | SSYBWYBCJQEDOB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC3=C2C=C(C=C3)N |
Computed by PubChem (NCBI)