CAS 265098-01-9 appears in our catalog under these names: GW406108X(Z/E)/ 99.71% (existing batch purity), GW406108X(Z/E), (Z/E)-GW406108X. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 50 mg.
(3Z)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-(furan-2-carbonyl)-1H-indol-2-one (CAS 265098-01-9) is a chemical compound with the molecular formula C20H11Cl2NO4 and a molecular weight of 400.2 g/mol. IUPAC name: (3Z)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-(furan-2-carbonyl)-1H-indol-2-one. InChIKey: XKTUKRBLWOHYIL-MLPAPPSSSA-N.
| Molecular formula | C20H11Cl2NO4 |
|---|---|
| Molecular weight | 400.2 g/mol |
| IUPAC name | (3Z)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-(furan-2-carbonyl)-1H-indol-2-one |
| InChIKey | XKTUKRBLWOHYIL-MLPAPPSSSA-N |
| SMILES | C1=COC(=C1)C(=O)C2=CC\3=C(C=C2)NC(=O)/C3=C\C4=CC(=C(C(=C4)Cl)O)Cl |
Computed by PubChem (NCBI)