cas: 1213206-88-2 — see every product listed under this CAS number, including other names
(s)-2-Amino-3-(4-bromo-2-fluorophenyl)propanoic acid (CAS 1213206-88-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F738346-250MG |
| cas | 1213206-88-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 612.30 Pln | |
| Fluorochem | 1g | 2049.30 Pln | |
| Fluorochem | 5g | 7453.64 Pln |
| delivery time | 3-4 weeks |
|---|
(2S)-2-amino-3-(4-bromo-2-fluorophenyl)propanoic acid (CAS 1213206-88-2) is a chemical compound with the molecular formula C9H9BrFNO2 and a molecular weight of 262.08 g/mol. IUPAC name: (2S)-2-amino-3-(4-bromo-2-fluorophenyl)propanoic acid. InChIKey: MQJFVIRBPSXVRP-QMMMGPOBSA-N.
| Molecular formula | C9H9BrFNO2 |
|---|---|
| Molecular weight | 262.08 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-bromo-2-fluorophenyl)propanoic acid |
| InChIKey | MQJFVIRBPSXVRP-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)