cas: 58624-17-2 — see every product listed under this CAS number, including other names
[(2,6-Dichloropyridin-3-yl)methyl]diethylamine (CAS 58624-17-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632141-1G |
| cas | 58624-17-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 5433.52 Pln | |
| Fluorochem | 5g | 16164.12 Pln |
| delivery time | 3-4 weeks |
|---|
N-[(2,6-dichloro-3-pyridinyl)methyl]-N-ethylethanamine (CAS 58624-17-2) is a chemical compound with the molecular formula C10H14Cl2N2 and a molecular weight of 233.13 g/mol. IUPAC name: N-[(2,6-dichloro-3-pyridinyl)methyl]-N-ethylethanamine. InChIKey: RTVWICXEJLQKQJ-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N2 |
|---|---|
| Molecular weight | 233.13 g/mol |
| IUPAC name | N-[(2,6-dichloro-3-pyridinyl)methyl]-N-ethylethanamine |
| InChIKey | RTVWICXEJLQKQJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC1=C(N=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)