Products 58624-17-2
CAS 58624-17-2 appears in our catalog under these names: [(2,6-Dichloropyridin-3-yl)methyl]diethylamine, 95%, [(2,6-Dichloropyridin-3-yl)methyl]diethylamine. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
N-[(2,6-dichloro-3-pyridinyl)methyl]-N-ethylethanamine (CAS 58624-17-2) is a chemical compound with the molecular formula C10H14Cl2N2 and a molecular weight of 233.13 g/mol. IUPAC name: N-[(2,6-dichloro-3-pyridinyl)methyl]-N-ethylethanamine. InChIKey: RTVWICXEJLQKQJ-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N2 |
|---|---|
| Molecular weight | 233.13 g/mol |
| IUPAC name | N-[(2,6-dichloro-3-pyridinyl)methyl]-N-ethylethanamine |
| InChIKey | RTVWICXEJLQKQJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC1=C(N=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)