Products 67735-80-2
CAS 67735-80-2 is the registry number for 2,5-Dichloro-3,6-diisopropylpyrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2,5-dichloro-3,6-di(propan-2-yl)pyrazine (CAS 67735-80-2) is a chemical compound with the molecular formula C10H14Cl2N2 and a molecular weight of 233.13 g/mol. IUPAC name: 2,5-dichloro-3,6-di(propan-2-yl)pyrazine. InChIKey: VIWJCQOQXHXBMS-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N2 |
|---|---|
| Molecular weight | 233.13 g/mol |
| IUPAC name | 2,5-dichloro-3,6-di(propan-2-yl)pyrazine |
| InChIKey | VIWJCQOQXHXBMS-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(N=C(C(=N1)Cl)C(C)C)Cl |
Computed by PubChem (NCBI)