Products 1301235-41-5
CAS 1301235-41-5 is the registry number for ((1S,2S)-2-((tert-Butyldimethylsilyl)oxy)cyclopentyl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentyl]methanol (CAS 1301235-41-5) is a chemical compound with the molecular formula C12H26O2Si and a molecular weight of 230.42 g/mol. IUPAC name: [(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentyl]methanol. InChIKey: QRELYVHEPVDASS-QWRGUYRKSA-N.
| Molecular formula | C12H26O2Si |
|---|---|
| Molecular weight | 230.42 g/mol |
| IUPAC name | [(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentyl]methanol |
| InChIKey | QRELYVHEPVDASS-QWRGUYRKSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@H]1CO |
Computed by PubChem (NCBI)