cas: 4341-02-0 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-2,2'-dicarbonitrile, 98%, 98% (CAS 4341-02-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DKKO-100mg |
| cas | 4341-02-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 462.80 Pln | |
| Chemat | 5g | 1629.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2-cyanophenyl)benzonitrile (CAS 4341-02-0) is a chemical compound with the molecular formula C14H8N2 and a molecular weight of 204.23 g/mol. IUPAC name: 2-(2-cyanophenyl)benzonitrile. InChIKey: XDQREGRMKWTMOO-UHFFFAOYSA-N.
| Molecular formula | C14H8N2 |
|---|---|
| Molecular weight | 204.23 g/mol |
| IUPAC name | 2-(2-cyanophenyl)benzonitrile |
| InChIKey | XDQREGRMKWTMOO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C2=CC=CC=C2C#N |
Computed by PubChem (NCBI)