CAS 86528-79-2 appears in our catalog under these names: 1,2-Dihydroacenaphthylene-5,6-dicarbonitrile 95%, 1,2-Dihydroacenaphthylene-5,6-dicarbonitrile, 95%, 95%, 1,2-Dihydroacenaphthylene-5,6-dicarbonitrile, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1,2-dihydroacenaphthylene-5,6-dicarbonitrile (CAS 86528-79-2) is a chemical compound with the molecular formula C14H8N2 and a molecular weight of 204.23 g/mol. IUPAC name: 1,2-dihydroacenaphthylene-5,6-dicarbonitrile. InChIKey: NUULUIKXLMNARB-UHFFFAOYSA-N.
| Molecular formula | C14H8N2 |
|---|---|
| Molecular weight | 204.23 g/mol |
| IUPAC name | 1,2-dihydroacenaphthylene-5,6-dicarbonitrile |
| InChIKey | NUULUIKXLMNARB-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=C(C3=C(C=CC1=C23)C#N)C#N |
Computed by PubChem (NCBI)