Products 86528-79-2

CAS 86528-79-2 appears in our catalog under these names: 1,2-Dihydroacenaphthylene-5,6-dicarbonitrile 95%, 1,2-Dihydroacenaphthylene-5,6-dicarbonitrile, 95%, 95%, 1,2-Dihydroacenaphthylene-5,6-dicarbonitrile, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1,2-dihydroacenaphthylene-5,6-dicarbonitrile (CAS 86528-79-2) is a chemical compound with the molecular formula C14H8N2 and a molecular weight of 204.23 g/mol. IUPAC name: 1,2-dihydroacenaphthylene-5,6-dicarbonitrile. InChIKey: NUULUIKXLMNARB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8N2
Molecular weight204.23 g/mol
IUPAC name1,2-dihydroacenaphthylene-5,6-dicarbonitrile
InChIKeyNUULUIKXLMNARB-UHFFFAOYSA-N
SMILESC1CC2=CC=C(C3=C(C=CC1=C23)C#N)C#N

Computed by PubChem (NCBI)