cas: 36978-36-6 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-2,3,3',4'-tetracarboxylicacid, 2,3,3',4'-tetramethyl ester, 95%, 95% (CAS 36978-36-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BY60-100mg |
| cas | 36978-36-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 736.40 Pln | |
| Chemat | 250mg | 1302.80 Pln | |
| Chemat | 1g | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Dimethyl 3-[3,4-bis(methoxycarbonyl)phenyl]benzene-1,2-dicarboxylate (CAS 36978-36-6) is a chemical compound with the molecular formula C20H18O8 and a molecular weight of 386.4 g/mol. IUPAC name: dimethyl 3-[3,4-bis(methoxycarbonyl)phenyl]benzene-1,2-dicarboxylate. InChIKey: KMUZCUGHNARCSD-UHFFFAOYSA-N.
| Molecular formula | C20H18O8 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | dimethyl 3-[3,4-bis(methoxycarbonyl)phenyl]benzene-1,2-dicarboxylate |
| InChIKey | KMUZCUGHNARCSD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C2=C(C(=CC=C2)C(=O)OC)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)