CAS 36978-37-7 appears in our catalog under these names: Tetramethyl 3,3',4,4'-biphenyltetracarboxylate, 95%, Tetramethyl (1,1'-biphenyl)-3,3',4,4'-tetracarboxylate, 98%, Tetramethyl 3,3',4,4'–biphenyltetracarboxylate, [1,1'-Biphenyl]-3,3',4,4'-tetracarboxylic acid, tetramethyl ester, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
Dimethyl 4-[3,4-bis(methoxycarbonyl)phenyl]benzene-1,2-dicarboxylate (CAS 36978-37-7) is a chemical compound with the molecular formula C20H18O8 and a molecular weight of 386.4 g/mol. IUPAC name: dimethyl 4-[3,4-bis(methoxycarbonyl)phenyl]benzene-1,2-dicarboxylate. InChIKey: NJIGQKCRWMSZBA-UHFFFAOYSA-N.
| Molecular formula | C20H18O8 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | dimethyl 4-[3,4-bis(methoxycarbonyl)phenyl]benzene-1,2-dicarboxylate |
| InChIKey | NJIGQKCRWMSZBA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C2=CC(=C(C=C2)C(=O)OC)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)