CAS 36978-36-6 appears in our catalog under these names: Biphenyl-2,3,3',4'-tetracarboxylic acid tetramethyl ester, 95%, etramethyl (1,1'–biphenyl)–2,3,3',4'–tetracarboxylate, [1,1'-Biphenyl]-2,3,3',4'-tetracarboxylicacid, 2,3,3',4'-tetramethyl ester, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg.
Dimethyl 3-[3,4-bis(methoxycarbonyl)phenyl]benzene-1,2-dicarboxylate (CAS 36978-36-6) is a chemical compound with the molecular formula C20H18O8 and a molecular weight of 386.4 g/mol. IUPAC name: dimethyl 3-[3,4-bis(methoxycarbonyl)phenyl]benzene-1,2-dicarboxylate. InChIKey: KMUZCUGHNARCSD-UHFFFAOYSA-N.
| Molecular formula | C20H18O8 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | dimethyl 3-[3,4-bis(methoxycarbonyl)phenyl]benzene-1,2-dicarboxylate |
| InChIKey | KMUZCUGHNARCSD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C2=C(C(=CC=C2)C(=O)OC)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)