cas: 1079-21-6 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-2,5-diol, 98% (CAS 1079-21-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239037-5G |
| cas | 1079-21-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 325.94 Pln | |
| Fluorochem | 10g | 575.86 Pln | |
| Fluorochem | 25g | 1065.27 Pln | |
| Fluorochem | 100g | 2627.22 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-phenylbenzene-1,4-diol (CAS 1079-21-6) is a chemical compound with the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. IUPAC name: 2-phenylbenzene-1,4-diol. InChIKey: XCZKKZXWDBOGPA-UHFFFAOYSA-N.
| Molecular formula | C12H10O2 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 2-phenylbenzene-1,4-diol |
| InChIKey | XCZKKZXWDBOGPA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)O)O |
Computed by PubChem (NCBI)