CAS 1079-21-6 appears in our catalog under these names: Phenylhydroquinone, 95%, 2-Phenylhydroquinone, >95% (HPLC), 2–Phenylhydroquinone, 2,5-Dihydroxybiphenyl, Phenylhydroquinone, >98.0%(GC)(T). Offered by: Combi-blocks, TRC, GLPBio, TargetMol, TCI. Available pack sizes: 1g, 25g, 5g, 50g, 5mg, 10mg, 25mg, 50mg.
2-phenylbenzene-1,4-diol (CAS 1079-21-6) is a chemical compound with the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. IUPAC name: 2-phenylbenzene-1,4-diol. InChIKey: XCZKKZXWDBOGPA-UHFFFAOYSA-N.
| Molecular formula | C12H10O2 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 2-phenylbenzene-1,4-diol |
| InChIKey | XCZKKZXWDBOGPA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)O)O |
Computed by PubChem (NCBI)