CAS 677010-20-7 appears in our catalog under these names: (1,1'–Biphenyl)–3,4',5–tricarboxylic acid, [1,1'-Biphenyl]-3,4',5-tricarboxylic Acid, >98.0%(GC)(T), [1,1'-Biphenyl]-3,4',5-tricarboxylic acid, 97%, [1,1'-Biphenyl]-3,4',5-tricarboxylic acid, 98%. Offered by: GLPBio, TCI, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 25g.
5-(4-carboxyphenyl)benzene-1,3-dicarboxylic acid (CAS 677010-20-7) is a chemical compound with the molecular formula C15H10O6 and a molecular weight of 286.24 g/mol. IUPAC name: 5-(4-carboxyphenyl)benzene-1,3-dicarboxylic acid. InChIKey: LQEZHWGJSWHXPJ-UHFFFAOYSA-N.
| Molecular formula | C15H10O6 |
|---|---|
| Molecular weight | 286.24 g/mol |
| IUPAC name | 5-(4-carboxyphenyl)benzene-1,3-dicarboxylic acid |
| InChIKey | LQEZHWGJSWHXPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)