Products 34196-40-2
CAS 34196-40-2 is the registry number for [1,1'-Biphenyl]-2,4,5-tricarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-phenylbenzene-1,2,4-tricarboxylic acid (CAS 34196-40-2) is a chemical compound with the molecular formula C15H10O6 and a molecular weight of 286.24 g/mol. IUPAC name: 5-phenylbenzene-1,2,4-tricarboxylic acid. InChIKey: NWQWAGHATPZVHV-UHFFFAOYSA-N.
| Molecular formula | C15H10O6 |
|---|---|
| Molecular weight | 286.24 g/mol |
| IUPAC name | 5-phenylbenzene-1,2,4-tricarboxylic acid |
| InChIKey | NWQWAGHATPZVHV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)