CAS 10228-40-7 is the registry number for 1,2,3,8-tetrahydroxy-6-methylanthracene-9,10-dione. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,8-tetrahydroxy-6-methylanthracene-9,10-dione (CAS 10228-40-7) is a chemical compound with the molecular formula C15H10O6 and a molecular weight of 286.24 g/mol. IUPAC name: 1,2,3,8-tetrahydroxy-6-methylanthracene-9,10-dione. InChIKey: OWKHJRBCPBBUGG-UHFFFAOYSA-N.
| Molecular formula | C15H10O6 |
|---|---|
| Molecular weight | 286.24 g/mol |
| IUPAC name | 1,2,3,8-tetrahydroxy-6-methylanthracene-9,10-dione |
| InChIKey | OWKHJRBCPBBUGG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C(=C(C=C3C2=O)O)O)O |
Computed by PubChem (NCBI)