[1,1'-Biphenyl]-4,4'-diamine, N4,N4,N4',N4'-tetraphenyl-, 96%, 96%
cas: 15546-43-7 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-4,4'-diamine, N4,N4,N4',N4'-tetraphenyl-, 96%, 96% (CAS 15546-43-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112NY4-1g |
| cas | 15546-43-7 |
| size | 1g |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 174.80 Pln | |
| Chemat | 25g | 242.00 Pln | |
| Chemat | 50g | 414.80 Pln | |
| Chemat | 100g | 746.00 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
N,N-diphenyl-4-[4-(N-phenylanilino)phenyl]aniline (CAS 15546-43-7) is a chemical compound with the molecular formula C36H28N2 and a molecular weight of 488.6 g/mol. IUPAC name: N,N-diphenyl-4-[4-(N-phenylanilino)phenyl]aniline. InChIKey: DCZNSJVFOQPSRV-UHFFFAOYSA-N.
| Molecular formula | C36H28N2 |
|---|---|
| Molecular weight | 488.6 g/mol |
| IUPAC name | N,N-diphenyl-4-[4-(N-phenylanilino)phenyl]aniline |
| InChIKey | DCZNSJVFOQPSRV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)N(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)
Synonyms:
N,N,N',N'-Tetraphenylbenzidine, Tetraphenylbenzidine, Triphenyl diamine, N,N,N',N'-Tetraphenyl(1,1'-biphenyl)-4,4'-diamine, N,N,N,N-Tetraphenylbenzidine, N4,N4,N4',N4'-Tetraphenyl-[1,1'-biphenyl]-4,4'-diamine, Tetra-N-phenylbenzidine, N,N-diphenyl-4-[4-(N-phenylanilino)phenyl]aniline, [1,1'-Biphenyl]-4,4'-diamine, N4,N4,N4',N4'-tetraphenyl-, N,N,N1,N1-Tetraphenylbenzidine