cas: 15546-43-7 — see every product listed under this CAS number, including other names
N,N,N',N'-Tetraphenylbenzidine, >98.0%(HPLC) (CAS 15546-43-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T1812-5G |
| cas | 15546-43-7 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 388.79 Pln | |
| TCI | 25g | 1037.87 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC) |
N,N-diphenyl-4-[4-(N-phenylanilino)phenyl]aniline (CAS 15546-43-7) is a chemical compound with the molecular formula C36H28N2 and a molecular weight of 488.6 g/mol. IUPAC name: N,N-diphenyl-4-[4-(N-phenylanilino)phenyl]aniline. InChIKey: DCZNSJVFOQPSRV-UHFFFAOYSA-N.
| Molecular formula | C36H28N2 |
|---|---|
| Molecular weight | 488.6 g/mol |
| IUPAC name | N,N-diphenyl-4-[4-(N-phenylanilino)phenyl]aniline |
| InChIKey | DCZNSJVFOQPSRV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)N(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)