cas: 15546-43-7 — see every product listed under this CAS number, including other names
N,N,N′,N′-Tetraphenylbenzidine, 95-<97% (CAS 15546-43-7) is a chemical reagent available from Chemat. Available pack sizes: 300g, 400g, 500g, 600g, 700g, 800g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC633-95-97-300g |
| cas | 15546-43-7 |
| size | 300g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 300g | 3230.04 Pln | |
| Hoffman Fine Chemicals | 400g | 3619.22 Pln | |
| Hoffman Fine Chemicals | 500g | 4033.92 Pln | |
| Hoffman Fine Chemicals | 600g | 4333.78 Pln | |
| Hoffman Fine Chemicals | 700g | 4537.94 Pln | |
| Hoffman Fine Chemicals | 800g | 4659.16 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
N,N-diphenyl-4-[4-(N-phenylanilino)phenyl]aniline (CAS 15546-43-7) is a chemical compound with the molecular formula C36H28N2 and a molecular weight of 488.6 g/mol. IUPAC name: N,N-diphenyl-4-[4-(N-phenylanilino)phenyl]aniline. InChIKey: DCZNSJVFOQPSRV-UHFFFAOYSA-N.
| Molecular formula | C36H28N2 |
|---|---|
| Molecular weight | 488.6 g/mol |
| IUPAC name | N,N-diphenyl-4-[4-(N-phenylanilino)phenyl]aniline |
| InChIKey | DCZNSJVFOQPSRV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)N(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)