cas: 2044702-44-3 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-4-methanol, 2'-methyl-, 4-acetate, 95%, 95% (CAS 2044702-44-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IKE3-250mg |
| cas | 2044702-44-3 |
| size | 250mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2267.60 Pln | |
| Chemat | 25g | 5574.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-(2-methylphenyl)phenyl]methyl acetate (CAS 2044702-44-3) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: [4-(2-methylphenyl)phenyl]methyl acetate. InChIKey: RIKOWCURBLYPNQ-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | [4-(2-methylphenyl)phenyl]methyl acetate |
| InChIKey | RIKOWCURBLYPNQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC=C(C=C2)COC(=O)C |
Computed by PubChem (NCBI)