Products 133151-37-8
CAS 133151-37-8 appears in our catalog under these names: (4'-Methyl-[1,1'-biphenyl]-4-yl)methyl acetate, 95%, (4'-Methyl-(1,1'-biphenyl)-4-yl)methyl acetate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
[4-(4-methylphenyl)phenyl]methyl acetate (CAS 133151-37-8) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: [4-(4-methylphenyl)phenyl]methyl acetate. InChIKey: MJZDHWXNYXSGCN-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | [4-(4-methylphenyl)phenyl]methyl acetate |
| InChIKey | MJZDHWXNYXSGCN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)COC(=O)C |
Computed by PubChem (NCBI)