CAS 890092-06-5 appears in our catalog under these names: 1-(4-[(3-Methylphenyl)methoxy]phenyl)ethan-1-one, 95%, 1-{4-((3-methylphenyl)methoxy)phenyl}ethan-1-one, 95%, 1-{4-((3-Methylphenyl)methoxy)phenyl}ethan-1-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
1-[4-[(3-methylphenyl)methoxy]phenyl]ethanone (CAS 890092-06-5) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: 1-[4-[(3-methylphenyl)methoxy]phenyl]ethanone. InChIKey: YGHXJHBIGWIVNU-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 1-[4-[(3-methylphenyl)methoxy]phenyl]ethanone |
| InChIKey | YGHXJHBIGWIVNU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)COC2=CC=C(C=C2)C(=O)C |
Computed by PubChem (NCBI)