cas: 1092563-41-1 — see every product listed under this CAS number, including other names
[2-Methyl-4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-phenyl]-pyrrolidin-1-yl-methanone, 95% (CAS 1092563-41-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696957-100MG |
| cas | 1092563-41-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 284.29 Pln | |
| Fluorochem | 250mg | 591.48 Pln | |
| Fluorochem | 1g | 2090.95 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-pyrrolidin-1-ylmethanone (CAS 1092563-41-1) is a chemical compound with the molecular formula C18H26BNO3 and a molecular weight of 315.2 g/mol. IUPAC name: [2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-pyrrolidin-1-ylmethanone. InChIKey: SWJZMZPRCHGWGV-UHFFFAOYSA-N.
| Molecular formula | C18H26BNO3 |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | [2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-pyrrolidin-1-ylmethanone |
| InChIKey | SWJZMZPRCHGWGV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)N3CCCC3)C |
Computed by PubChem (NCBI)