Products 643094-23-9
CAS 643094-23-9 is the registry number for 2-(Piperidin-1-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 97%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-piperidin-1-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 643094-23-9) is a chemical compound with the molecular formula C18H26BNO3 and a molecular weight of 315.2 g/mol. IUPAC name: 2-piperidin-1-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: WXONITOQLQZUTQ-UHFFFAOYSA-N.
| Molecular formula | C18H26BNO3 |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | 2-piperidin-1-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | WXONITOQLQZUTQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C=O)N3CCCCC3 |
Computed by PubChem (NCBI)