cas: 1100095-25-7 — see every product listed under this CAS number, including other names
[3-(1H-PYRAZOL-3-YL)PHENYL]BORONIC ACID, 98%, 98% (CAS 1100095-25-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HBNO-100mg |
| cas | 1100095-25-7 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 2661.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[3-(1H-pyrazol-5-yl)phenyl]boronic acid (CAS 1100095-25-7) is a chemical compound with the molecular formula C9H9BN2O2 and a molecular weight of 187.99 g/mol. IUPAC name: [3-(1H-pyrazol-5-yl)phenyl]boronic acid. InChIKey: VRRAGHYTEHJUTF-UHFFFAOYSA-N.
| Molecular formula | C9H9BN2O2 |
|---|---|
| Molecular weight | 187.99 g/mol |
| IUPAC name | [3-(1H-pyrazol-5-yl)phenyl]boronic acid |
| InChIKey | VRRAGHYTEHJUTF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=CC=NN2)(O)O |
Computed by PubChem (NCBI)