CAS 891270-35-2 appears in our catalog under these names: 4-(1H-Pyrazol-1-yl)phenylboronic acid, 98%, (4-(Pyrazol-1-yl)phenyl)boronic acid, 95-<97%, (4-(Pyrazol-1-yl)phenyl)boronic acid, ≥97-<99%, 4-Pyrazol-1-yl-phenylboronic Acid, (4-(1H-Pyrazol-1-yl)phenyl)boronic acid, 97%, 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, TRC, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 50g, 100g, 200g, 300g.
(4-pyrazol-1-ylphenyl)boronic acid (CAS 891270-35-2) is a chemical compound with the molecular formula C9H9BN2O2 and a molecular weight of 187.99 g/mol. IUPAC name: (4-pyrazol-1-ylphenyl)boronic acid. InChIKey: XTVMZKCCFLOJBL-UHFFFAOYSA-N.
| Molecular formula | C9H9BN2O2 |
|---|---|
| Molecular weight | 187.99 g/mol |
| IUPAC name | (4-pyrazol-1-ylphenyl)boronic acid |
| InChIKey | XTVMZKCCFLOJBL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N2C=CC=N2)(O)O |
Computed by PubChem (NCBI)