CAS 476620-22-1 appears in our catalog under these names: 3-Pyrazol-1-yl-phenylboronic acid, 98%, (3–(1H–pyrazol–1–yl)phenyl)boronic acid, (3-(1H-pyrazol-1-yl)phenyl)boronic acid, 98%, 98%, (3-(1H-pyrazol-1-yl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
(3-pyrazol-1-ylphenyl)boronic acid (CAS 476620-22-1) is a chemical compound with the molecular formula C9H9BN2O2 and a molecular weight of 187.99 g/mol. IUPAC name: (3-pyrazol-1-ylphenyl)boronic acid. InChIKey: NMBKAXJHGMDYGA-UHFFFAOYSA-N.
| Molecular formula | C9H9BN2O2 |
|---|---|
| Molecular weight | 187.99 g/mol |
| IUPAC name | (3-pyrazol-1-ylphenyl)boronic acid |
| InChIKey | NMBKAXJHGMDYGA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)N2C=CC=N2)(O)O |
Computed by PubChem (NCBI)